Quantitative metabolomics services for biomarker discovery and validation.
Specializing in ready to use metabolomics kits.
Your source for quantitative metabolomics technologies and bioinformatics.

Loading Pathway...

1.0 53481369 PubChem-compound Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol Cytidine triphosphate 1.0 6132 PubChem-compound CHEBI:17239 ChEBI UDP C21H39O9P Dolichyl b-D-glucosyl phosphate 466.23315 1.0 N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase CHEBI:58223 ChEBI CHEBI:16264 ChEBI SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 528-04-1 CAS 1.0 63-38-7 CAS SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)OP(O)(=O)OC1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])N=C(C)[O-])=C(\C)CCC=C(C)C C9H14N2O12P2 UDP 404.0022 Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase CHEBI:15820 ChEBI Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Dolichyl b-D-glucosyl phosphate Dolichyl-phosphate beta-glucosyltransferase 1038 PubChem-compound Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase 1.0 SMILES CC(CCOP([O-])(=O)OP([O-])(=O)OC1OC(CO)C(OC2OC(CO)C(OC3OC(COC4OC(COC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C(O)C(OC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C4O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(OC5OC(CO)C(O)C(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C5O)C4O)C3O)C(O)C2NC(C)=O)C(O)C1NC(C)=O)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C NN-DIACETYLCHITOBIOSYLDIPHOSPHODOLICHO BioCyc SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)O[C@]1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@]1([H])O)=C(\C)CCC=C(C)C Alpha-1,2-mannosyltransferase ALG9 P40351 UniProt C96H160N2O17P2 (N-Acetylglucosaminyl)2-diphosphodolichol 1675.1193 P40350 UniProt C150H250N2O62P2 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3133.5947 C144H240N2O57P2 (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol 2971.5417 C114H190N2O32P2 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 2161.2776 C138H230N2O52P2 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol 2809.489 C132H220N2O47P2 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol 2647.4363 393240 ChemSpider C126H210N2O42P2 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol 2485.3833 Dolichol-phosphate mannosyltransferase Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase C04537 KEGG Compound C00105 KEGG Compound 6030 PubChem-compound UDP-N-acetylglucosamine transferase subunit ALG14 53481378 PubChem-compound 53477679 PubChem-compound Chitobiosyldiphosphodolichol beta-mannosyltransferase 2067-66-5 CAS Alpha-1,3/1,6-mannosyltransferase ALG2 GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase 133-89-1 CAS dolichol kinase UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase UDP-N-acetylglucosamine transferase Alg13p subunit 1010 ChemSpider C10H15N5O11P2 Guanosine diphosphate 443.02432 Saccharomyces cerevisiae 53481374 PubChem-compound 53481375 PubChem-compound P43636 UniProt P38179 UniProt 53481376 PubChem-compound 53481377 PubChem-compound 53481370 PubChem-compound 53481371 PubChem-compound 53481373 PubChem-compound 1.0 Hydrogen Ion C88H145NO12P2 N-acetyl-α-D-glucosaminyl-diphosphodolichol 1470.0253 C168H278N2O77P2 (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3617.7385 C86H142O9P dolichyl β-D-mannosyl phosphate 1350.0397 C00112 KEGG Compound C15H24N2O17P2 Uridine diphosphate glucose 566.055 UDP-GLUCOSE BioCyc P20048 UniProt CDP HMDB0001546 HMDB 5280322 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 1.0 SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H](NC(C)=O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 25245072 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O C17H27N3O17P2 Uridine diphosphate-N-acetylglucosamine 607.08154 1.0 C9H13N2O9P Uridine 5'-monophosphate 324.03586 P38242 UniProt GDP-MANNOSE BioCyc CTP BioCyc SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE BioCyc CDP BioCyc 2.4.1.141 false 2.4.1.141 N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine diphosphate-N-acetylglucosamine ? UDP + (N-Acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion 2.7.8.15 false 2.7.8.15 Dolichol phosphate + Uridine diphosphate-N-acetylglucosamine → N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine 5'-monophosphate LEFT_TO_RIGHT 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 Guanosine diphosphate mannose + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol → (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.142 false 2.4.1.142 (N-Acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → Guanosine diphosphate + Hydrogen Ion + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol LEFT_TO_RIGHT 2.4.1.131 false 2.4.1.131 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + 2 Guanosine diphosphate + 2 Hydrogen Ion LEFT_TO_RIGHT 1.0 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT P53868 UniProt 25245534 PubChem-compound SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1 Uridine diphosphate-N-acetylglucosamine HMDB0001201 HMDB SMILES CC(CCO)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C Uridine 5'-monophosphate Uridine diphosphate glucose 17372 ChemSpider C00381 KEGG Compound C102H170N2O22P2 Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol 1837.172 2.7.1.108 false 2.7.1.108 Cytidine triphosphate + Dolichol-20 → CDP + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT C9H16N3O14P3 Cytidine triphosphate 482.9845 4444045 ChemSpider H Hydrogen Ion 1.007825 C00029 KEGG Compound 1.0 220496-27-5 CAS SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O[C@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 1.0 6433320 PubChem-compound 1.0 1.0 SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O HMDB0012117 HMDB HMDB0012118 HMDB HMDB0012119 HMDB C01246 KEGG Compound C00035 KEGG Compound HMDB0012232 HMDB SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O)[C@@H]1O CHEBI:16091 ChEBI SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 HMDB0006353 HMDB HMDB0012123 HMDB Reaction7070 false (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT HMDB0012124 HMDB P53178 UniProt HMDB0012125 HMDB 2.4.1.117 false 2.4.1.117 Dolichol phosphate + Uridine diphosphate glucose → UDP + Dolichyl b-D-glucosyl phosphate LEFT_TO_RIGHT HMDB0012126 HMDB 2.4.1.267 false 2.4.1.267 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → Dolichol phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7034 ACTIVATION P53730 UniProt 2.4.1.256 false 2.4.1.256 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.265 false 2.4.1.265 Dolichyl b-D-glucosyl phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol → (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 1.0 (C5H8)nC10H21O4P Dolichol phosphate C00043 KEGG Compound HMDB0012121 HMDB 1.0 HMDB0012122 HMDB 58-97-9 CAS 1.0 P16661 UniProt ReactionCatalysis7038 ACTIVATION 2.4.1.258 false 2.4.1.258 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.83 false 2.4.1.83 Dolichol phosphate + Guanosine diphosphate mannose → Guanosine diphosphate + dolichyl β-D-mannosyl phosphate LEFT_TO_RIGHT 2.4.1.260 false 2.4.1.260 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.259,2.4.1.261 false 2.4.1.259,2.4.1.261 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7039 ACTIVATION dolichol kinase 5902 ChemSpider HMDB0012255 HMDB ReactionCatalysis7041 ACTIVATION PW002501 PathWhiz ReactionCatalysis7040 ACTIVATION UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase ReactionCatalysis7045 ACTIVATION ReactionCatalysis7044 ACTIVATION ReactionCatalysis7043 ACTIVATION ReactionCatalysis7042 ACTIVATION P07286 UniProt Dolichol phosphate 22833557 PubChem-compound C00063 KEGG Compound C9H15N3O11P2 CDP 403.0182 C00110 KEGG Compound Dolichol-phosphate mannosyltransferase ReactionCatalysis7049 ACTIVATION GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase ReactionCatalysis7048 ACTIVATION ReactionCatalysis7047 ACTIVATION ALPHA-D-MANNOSYLCHITOBIO BioCyc Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase ReactionCatalysis7046 ACTIVATION UDP-N-acetylglucosamine transferase subunit ALG14 UDP-N-acetylglucosamine transferase Alg13p subunit Alpha-1,3/1,6-mannosyltransferase ALG2 Chitobiosyldiphosphodolichol beta-mannosyltransferase Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase ReactionCatalysis7052 ACTIVATION Alpha-1,2-mannosyltransferase ALG9 ReactionCatalysis7051 ACTIVATION Dolichyl-phosphate beta-glucosyltransferase ReactionCatalysis7050 ACTIVATION N-acetyl-α-D-glucosaminyl-diphosphodolichol Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase 445675 PubChem-compound P53954 UniProt UDP-N-ACETYL-D-GLUCOSAMINE BioCyc 1.0 8977 PubChem-compound SMILES OC[C@H]1O[C@@H](OP(=O)(O)OCCC(C)CC\C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol dolichyl β-D-mannosyl phosphate N-Glycan Biosynthesis HMDB0000288 HMDB P14020 UniProt 65-47-4 CAS 1.0 1.0 HMDB0005176 HMDB Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase HMDB0000286 HMDB C16H25N5O16P2 Guanosine diphosphate mannose 605.07715 Guanosine diphosphate 8630 ChemSpider CHEBI:16695 ChEBI CPD-171 BioCyc C00080 KEGG Compound (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol (N-Acetylglucosaminyl)2-diphosphodolichol (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol C100H164O Dolichol-20 1381.2782 SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol HMDB0000290 HMDB (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 1.0 5808 ChemSpider 1.0 CHEBI:17677 ChEBI CPD-5169 BioCyc 6176 PubChem-compound CHEBI:15378 ChEBI SMILES [H+] CHEBI:15812 ChEBI CHEBI:17552 ChEBI CPD-5167 BioCyc CPD-5166 BioCyc CPD-5165 BioCyc (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 3123-67-9 CAS 1.0 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol C00096 KEGG Compound CPD-5170 BioCyc C108H180N2O27P2 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 1999.2249 C162H270N2O72P2 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3457.7002 53481393 PubChem-compound 53481395 PubChem-compound Q12001 UniProt 4932 TAXONOMY 5941 ChemSpider 2.0 Dolichol-20 1.0 SMILES CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O 18396 PubChem-compound SMP0002400 SMPDB SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)N1C=CC(=O)NC1=O 4938490 ChemSpider HMDB0001163 HMDB SMILES OC[C@@H]1OC(OP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)N2C=CC(=O)NC2=O)[C@@H](O)[C@H](O)[C@H]1O P50076 UniProt 1.0 2.0 HMDB0059597 HMDB UMP BioCyc 1.0 Guanosine diphosphate mannose Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 146-91-8 CAS 17216044 ChemSpider C156H260N2O67P2 Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3295.6475 HMDB0000082 HMDB HMDB0001054 HMDB 34457-14-2 CAS dolichol kinase UDP-N- acetylglucosamine- -dolichyl- phosphate N- acetylglucosaminephosphotransferase UDP-N- acetylglucosamine transferase Alg13p subunit UDP-N- acetylglucosamine transferase subunit ALG14 Chitobiosyldiphosphodolichol beta- mannosyltransferase Dolichol- phosphate mannosyltransferase Alpha- 1,3/1,6- mannosyltransferase ALG2 Alpha- 1,3/1,6- mannosyltransferase ALG2 GDP- Man:Man(3)GlcNAc(2)- PP-Dol alpha-1,2- mannosyltransferase Dol-P- Man:Man(5)GlcNAc(2)- PP-Dol alpha-1,3- mannosyltransferase Alpha-1,2- mannosyltransferase ALG9 Dol-P- Man:Man(7)GlcNAc(2)- PP-Dol alpha-1,6- mannosyltransferase Alpha-1,2- mannosyltransferase ALG9 Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3- glucosyltransferase Dolichyl- phosphate beta- glucosyltransferase Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3- glucosyltransferase Dol-P- Glc:Glc(2)Man(9)GlcNAc(2)- PP-Dol alpha-1,2- glucosyltransferase Dolichol-20 Cytidine triphosphate Dolichol phosphate H + CDP Uridine diphosphate- N- acetylglucosamine Uridine 5'- monophosphate N-acetyl-α-D- glucosaminyl- diphosphodolichol Uridine diphosphate- N- acetylglucosamine (N- Acetylglucosaminyl)2- diphosphodolichol UDP H + Guanosine diphosphate mannose Mannosyl-(N- acetylglucosaminyl)2- diphosphodolichol GDP H + Guanosine diphosphate mannose Dolichol phosphate GDP dolichyl β-D-mannosyl phosphate Guanosine diphosphate mannose (Mannosyl)2- (N- acetylglucosaminyl)2- diphosphodolichol GDP H + Guanosine diphosphate mannose GDP H + (Mannosyl)3- (N- acetylglucosaminyl)2- diphosphodolichol Guanosine diphosphate mannose (Mannosyl)5- (N- acetylglucosaminyl)2- diphosphodolichol GDP H + dolichyl β-D-mannosyl phosphate Dolichol phosphate H + (Mannosyl)6- (N- acetylglucosaminyl)2- diphosphodolichol dolichyl β-D-mannosyl phosphate (Mannosyl)7- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + dolichyl β-D-mannosyl phosphate (Mannosyl)8- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + dolichyl β-D-mannosyl phosphate (Mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + Dolichyl b-D-glucosyl phosphate Glucosyl- (mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + Uridine diphosphate glucose Dolichol phosphate UDP Dolichyl b-D-glucosyl phosphate (Glucosyl)2(mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + Dolichyl b-D-glucosyl phosphate H + Dolichol phosphate (glucosyl)3(mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol
1.0 53481369 PubChem-compound Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol Cytidine triphosphate 1.0 6132 PubChem-compound CHEBI:17239 ChEBI UDP C21H39O9P Dolichyl b-D-glucosyl phosphate 466.23315 1.0 N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase CHEBI:58223 ChEBI CHEBI:16264 ChEBI SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 528-04-1 CAS 1.0 63-38-7 CAS SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)OP(O)(=O)OC1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])N=C(C)[O-])=C(\C)CCC=C(C)C C9H14N2O12P2 UDP 404.0022 Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase CHEBI:15820 ChEBI Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Dolichyl b-D-glucosyl phosphate Dolichyl-phosphate beta-glucosyltransferase 1038 PubChem-compound Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase 1.0 SMILES CC(CCOP([O-])(=O)OP([O-])(=O)OC1OC(CO)C(OC2OC(CO)C(OC3OC(COC4OC(COC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C(O)C(OC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C4O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(OC5OC(CO)C(O)C(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C5O)C4O)C3O)C(O)C2NC(C)=O)C(O)C1NC(C)=O)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C NN-DIACETYLCHITOBIOSYLDIPHOSPHODOLICHO BioCyc SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)O[C@]1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@]1([H])O)=C(\C)CCC=C(C)C Alpha-1,2-mannosyltransferase ALG9 P40351 UniProt C96H160N2O17P2 (N-Acetylglucosaminyl)2-diphosphodolichol 1675.1193 P40350 UniProt C150H250N2O62P2 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3133.5947 C144H240N2O57P2 (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol 2971.5417 C114H190N2O32P2 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 2161.2776 C138H230N2O52P2 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol 2809.489 C132H220N2O47P2 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol 2647.4363 393240 ChemSpider C126H210N2O42P2 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol 2485.3833 Dolichol-phosphate mannosyltransferase Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase C04537 KEGG Compound C00105 KEGG Compound 6030 PubChem-compound UDP-N-acetylglucosamine transferase subunit ALG14 53481378 PubChem-compound 53477679 PubChem-compound Chitobiosyldiphosphodolichol beta-mannosyltransferase 2067-66-5 CAS Alpha-1,3/1,6-mannosyltransferase ALG2 GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase 133-89-1 CAS dolichol kinase UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase UDP-N-acetylglucosamine transferase Alg13p subunit 1010 ChemSpider C10H15N5O11P2 Guanosine diphosphate 443.02432 Saccharomyces cerevisiae 53481374 PubChem-compound 53481375 PubChem-compound P43636 UniProt P38179 UniProt 53481376 PubChem-compound 53481377 PubChem-compound 53481370 PubChem-compound 53481371 PubChem-compound 53481373 PubChem-compound 1.0 Hydrogen Ion C88H145NO12P2 N-acetyl-α-D-glucosaminyl-diphosphodolichol 1470.0253 C168H278N2O77P2 (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3617.7385 C86H142O9P dolichyl β-D-mannosyl phosphate 1350.0397 C00112 KEGG Compound C15H24N2O17P2 Uridine diphosphate glucose 566.055 UDP-GLUCOSE BioCyc P20048 UniProt CDP HMDB0001546 HMDB 5280322 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 1.0 SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H](NC(C)=O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 25245072 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O C17H27N3O17P2 Uridine diphosphate-N-acetylglucosamine 607.08154 1.0 C9H13N2O9P Uridine 5'-monophosphate 324.03586 P38242 UniProt GDP-MANNOSE BioCyc CTP BioCyc SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE BioCyc CDP BioCyc 2.4.1.141 false 2.4.1.141 N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine diphosphate-N-acetylglucosamine ? UDP + (N-Acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion 2.7.8.15 false 2.7.8.15 Dolichol phosphate + Uridine diphosphate-N-acetylglucosamine → N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine 5'-monophosphate LEFT_TO_RIGHT 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 Guanosine diphosphate mannose + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol → (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.142 false 2.4.1.142 (N-Acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → Guanosine diphosphate + Hydrogen Ion + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol LEFT_TO_RIGHT 2.4.1.131 false 2.4.1.131 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + 2 Guanosine diphosphate + 2 Hydrogen Ion LEFT_TO_RIGHT 1.0 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT P53868 UniProt 25245534 PubChem-compound SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1 Uridine diphosphate-N-acetylglucosamine HMDB0001201 HMDB SMILES CC(CCO)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C Uridine 5'-monophosphate Uridine diphosphate glucose 17372 ChemSpider C00381 KEGG Compound C102H170N2O22P2 Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol 1837.172 2.7.1.108 false 2.7.1.108 Cytidine triphosphate + Dolichol-20 → CDP + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT C9H16N3O14P3 Cytidine triphosphate 482.9845 4444045 ChemSpider H Hydrogen Ion 1.007825 C00029 KEGG Compound 1.0 220496-27-5 CAS SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O[C@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 1.0 6433320 PubChem-compound 1.0 1.0 SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O HMDB0012117 HMDB HMDB0012118 HMDB HMDB0012119 HMDB C01246 KEGG Compound C00035 KEGG Compound HMDB0012232 HMDB SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O)[C@@H]1O CHEBI:16091 ChEBI SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 HMDB0006353 HMDB HMDB0012123 HMDB Reaction7070 false (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT HMDB0012124 HMDB P53178 UniProt HMDB0012125 HMDB 2.4.1.117 false 2.4.1.117 Dolichol phosphate + Uridine diphosphate glucose → UDP + Dolichyl b-D-glucosyl phosphate LEFT_TO_RIGHT HMDB0012126 HMDB 2.4.1.267 false 2.4.1.267 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → Dolichol phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7034 ACTIVATION P53730 UniProt 2.4.1.256 false 2.4.1.256 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.265 false 2.4.1.265 Dolichyl b-D-glucosyl phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol → (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 1.0 (C5H8)nC10H21O4P Dolichol phosphate C00043 KEGG Compound HMDB0012121 HMDB 1.0 HMDB0012122 HMDB 58-97-9 CAS 1.0 P16661 UniProt ReactionCatalysis7038 ACTIVATION 2.4.1.258 false 2.4.1.258 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.83 false 2.4.1.83 Dolichol phosphate + Guanosine diphosphate mannose → Guanosine diphosphate + dolichyl β-D-mannosyl phosphate LEFT_TO_RIGHT 2.4.1.260 false 2.4.1.260 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.259,2.4.1.261 false 2.4.1.259,2.4.1.261 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7039 ACTIVATION dolichol kinase 5902 ChemSpider HMDB0012255 HMDB ReactionCatalysis7041 ACTIVATION PW002501 PathWhiz ReactionCatalysis7040 ACTIVATION UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase ReactionCatalysis7045 ACTIVATION ReactionCatalysis7044 ACTIVATION ReactionCatalysis7043 ACTIVATION ReactionCatalysis7042 ACTIVATION P07286 UniProt Dolichol phosphate 22833557 PubChem-compound C00063 KEGG Compound C9H15N3O11P2 CDP 403.0182 C00110 KEGG Compound Dolichol-phosphate mannosyltransferase ReactionCatalysis7049 ACTIVATION GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase ReactionCatalysis7048 ACTIVATION ReactionCatalysis7047 ACTIVATION ALPHA-D-MANNOSYLCHITOBIO BioCyc Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase ReactionCatalysis7046 ACTIVATION UDP-N-acetylglucosamine transferase subunit ALG14 UDP-N-acetylglucosamine transferase Alg13p subunit Alpha-1,3/1,6-mannosyltransferase ALG2 Chitobiosyldiphosphodolichol beta-mannosyltransferase Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase ReactionCatalysis7052 ACTIVATION Alpha-1,2-mannosyltransferase ALG9 ReactionCatalysis7051 ACTIVATION Dolichyl-phosphate beta-glucosyltransferase ReactionCatalysis7050 ACTIVATION N-acetyl-α-D-glucosaminyl-diphosphodolichol Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase 445675 PubChem-compound P53954 UniProt UDP-N-ACETYL-D-GLUCOSAMINE BioCyc 1.0 8977 PubChem-compound SMILES OC[C@H]1O[C@@H](OP(=O)(O)OCCC(C)CC\C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol dolichyl β-D-mannosyl phosphate N-Glycan Biosynthesis HMDB0000288 HMDB P14020 UniProt 65-47-4 CAS 1.0 1.0 HMDB0005176 HMDB Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase HMDB0000286 HMDB C16H25N5O16P2 Guanosine diphosphate mannose 605.07715 Guanosine diphosphate 8630 ChemSpider CHEBI:16695 ChEBI CPD-171 BioCyc C00080 KEGG Compound (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol (N-Acetylglucosaminyl)2-diphosphodolichol (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol C100H164O Dolichol-20 1381.2782 SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol HMDB0000290 HMDB (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 1.0 5808 ChemSpider 1.0 CHEBI:17677 ChEBI CPD-5169 BioCyc 6176 PubChem-compound CHEBI:15378 ChEBI SMILES [H+] CHEBI:15812 ChEBI CHEBI:17552 ChEBI CPD-5167 BioCyc CPD-5166 BioCyc CPD-5165 BioCyc (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 3123-67-9 CAS 1.0 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol C00096 KEGG Compound CPD-5170 BioCyc C108H180N2O27P2 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 1999.2249 C162H270N2O72P2 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3457.7002 53481393 PubChem-compound 53481395 PubChem-compound Q12001 UniProt 4932 TAXONOMY 5941 ChemSpider 2.0 Dolichol-20 1.0 SMILES CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O 18396 PubChem-compound SMP0002400 SMPDB SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)N1C=CC(=O)NC1=O 4938490 ChemSpider HMDB0001163 HMDB SMILES OC[C@@H]1OC(OP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)N2C=CC(=O)NC2=O)[C@@H](O)[C@H](O)[C@H]1O P50076 UniProt 1.0 2.0 HMDB0059597 HMDB UMP BioCyc 1.0 Guanosine diphosphate mannose Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 146-91-8 CAS 17216044 ChemSpider C156H260N2O67P2 Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3295.6475 HMDB0000082 HMDB HMDB0001054 HMDB 34457-14-2 CAS